C20H29NO — CID 22807476
3-[(4aS,8aR)-2-(3-methylbut-2-enyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenol (PubChem CID 22807476) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is 3-[(4aS,8aR)-2-(3-methylbut-2-enyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenol.
| Compound Name | 3-[(4aS,8aR)-2-(3-methylbut-2-enyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenol |
|---|---|
| PubChem CID | 22807476 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 3-[(4aS,8aR)-2-(3-methylbut-2-enyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenol |
| SMILES | CC(C)=CCN1CC[C@@]2(c3cccc(O)c3)CCCC[C@H]2C1 |
| InChI | InChI=1S/C20H29NO/c1-16(2)9-12-21-13-11-20(10-4-3-6-18(20)15-21)17-7-5-8-19(22)14-17/h5,7-9,14,18,22H,3-4,6,10-13,15H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | JIJACGAJAQVADP-AZUAARDMSA-N |
| XLogP | 4.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|