C16H19NO2 — CID 22807512
(4aS,8aR)-2-methyl-4a-phenyl-4,5,6,7,8,8a-hexahydroisoquinoline-1,3-dione (PubChem CID 22807512) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (4aS,8aR)-2-methyl-4a-phenyl-4,5,6,7,8,8a-hexahydroisoquinoline-1,3-dione.
| Compound Name | (4aS,8aR)-2-methyl-4a-phenyl-4,5,6,7,8,8a-hexahydroisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 22807512 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (4aS,8aR)-2-methyl-4a-phenyl-4,5,6,7,8,8a-hexahydroisoquinoline-1,3-dione |
| SMILES | CN1C(=O)C[C@@]2(c3ccccc3)CCCC[C@H]2C1=O |
| InChI | InChI=1S/C16H19NO2/c1-17-14(18)11-16(12-7-3-2-4-8-12)10-6-5-9-13(16)15(17)19/h2-4,7-8,13H,5-6,9-11H2,1H3/t13-,16+/m0/s1 |
| InChIKey | AYKOCNRDYSODOJ-XJKSGUPXSA-N |
| XLogP | 2.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|