C10H18ClN3O8 — CID 22808148
1-(2-chloroethyl)-3-[hydroxy-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]-1-nitrosourea (PubChem CID 22808148) has the molecular formula C10H18ClN3O8 and a molecular weight of 343.72 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[hydroxy-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-[hydroxy-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]-1-nitrosourea |
|---|---|
| PubChem CID | 22808148 |
| Molecular Formula | C10H18ClN3O8 |
| Molecular Weight | 343.72 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 1-(2-chloroethyl)-3-[hydroxy-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]-1-nitrosourea |
| SMILES | CO[C@@H]1O[C@H](C(O)NC(=O)N(CCCl)N=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18ClN3O8/c1-21-9-6(17)4(15)5(16)7(22-9)8(18)12-10(19)14(13-20)3-2-11/h4-9,15-18H,2-3H2,1H3,(H,12,19)/t4-,5-,6+,7-,8?,9+/m0/s1 |
| InChIKey | FTHHQXLNDCDABF-LSUJUSNUSA-N |
| XLogP | -2.31 |
| TPSA | 161.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.72 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|