C6H6Br6 — CID 22808489
(4S)-1,1,2,3,3,4-hexabromohex-1-ene (PubChem CID 22808489) has the molecular formula C6H6Br6 and a molecular weight of 557.54 g/mol. Its IUPAC name is (4S)-1,1,2,3,3,4-hexabromohex-1-ene.
| Compound Name | (4S)-1,1,2,3,3,4-hexabromohex-1-ene |
|---|---|
| PubChem CID | 22808489 |
| Molecular Formula | C6H6Br6 |
| Molecular Weight | 557.54 g/mol |
| Exact Mass | 551.56 |
| IUPAC Name | (4S)-1,1,2,3,3,4-hexabromohex-1-ene |
| SMILES | CC[C@H](Br)C(Br)(Br)C(Br)=C(Br)Br |
| InChI | InChI=1S/C6H6Br6/c1-2-3(7)6(11,12)4(8)5(9)10/h3H,2H2,1H3/t3-/m0/s1 |
| InChIKey | FKIAPTAKYOGDMD-VKHMYHEASA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|