C22H20F6O4 — CID 22808593
(3S,3aR,6R,6aR)-3,6-bis[[2-(trifluoromethyl)phenyl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 22808593) has the molecular formula C22H20F6O4 and a molecular weight of 462.39 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3,6-bis[[2-(trifluoromethyl)phenyl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aR,6R,6aR)-3,6-bis[[2-(trifluoromethyl)phenyl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 22808593 |
| Molecular Formula | C22H20F6O4 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (3S,3aR,6R,6aR)-3,6-bis[[2-(trifluoromethyl)phenyl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | FC(F)(F)c1ccccc1CO[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H20F6O4/c23-21(24,25)15-7-3-1-5-13(15)9-29-17-11-31-20-18(12-32-19(17)20)30-10-14-6-2-4-8-16(14)22(26,27)28/h1-8,17-20H,9-12H2/t17-,18+,19-,20-/m1/s1 |
| InChIKey | SNVYNXIFTCUFAL-IYWMVGAKSA-N |
| XLogP | 4.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |