C13H14Cl2O4 — CID 22808604
(3S,3aR,6R,6aR)-6-[(3,4-dichlorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 22808604) has the molecular formula C13H14Cl2O4 and a molecular weight of 305.16 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-6-[(3,4-dichlorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3S,3aR,6R,6aR)-6-[(3,4-dichlorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 22808604 |
| Molecular Formula | C13H14Cl2O4 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | (3S,3aR,6R,6aR)-6-[(3,4-dichlorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2O4/c14-8-2-1-7(3-9(8)15)4-17-11-6-19-12-10(16)5-18-13(11)12/h1-3,10-13,16H,4-6H2/t10-,11+,12+,13+/m0/s1 |
| InChIKey | INCVUXJVQRHMDA-UMSGYPCISA-N |
| XLogP | 2.04 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |