About 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol
2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol (PubChem CID 22808676) has the molecular formula C23H44O
and a molecular weight of 336.60 g/mol. Its IUPAC name is 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol.
Molecular Properties
| Compound Name | 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol |
| PubChem CID | 22808676 |
| Molecular Formula | C23H44O |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 336.34 |
| IUPAC Name | 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol |
| SMILES | CCCCCC/C=C/[C@H]1CCC[C@@H]1CCCCCCC(CC)CO |
| InChI | InChI=1S/C23H44O/c1-3-5-6-7-8-12-16-22-18-14-19-23(22)17-13-10-9-11-15-21(4-2)20-24/h12,16,21-24H,3-11,13-15,17-20H2,1-2H3/b16-12+/t21?,22-,23-/m0/s1 |
| InChIKey | ZQRBTRAQBWNWNG-ISFZMGKFSA-N |
| XLogP | 7.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol?
The IUPAC name of 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol (CID 22808676) is 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol.
What is the SMILES notation for 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol?
The canonical SMILES for 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol is CCCCCC/C=C/[C@H]1CCC[C@@H]1CCCCCCC(CC)CO.
What is the InChIKey of 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol?
The InChIKey is ZQRBTRAQBWNWNG-ISFZMGKFSA-N. The full InChI is InChI=1S/C23H44O/c1-3-5-6-7-8-12-16-22-18-14-19-23(22)17-13-10-9-11-15-21(4-2)20-24/h12,16,21-24H,3-11,13-15,17-20H2,1-2H3/b16-12+/t21?,22-,23-/m0/s1.
What are the key properties of 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol?
2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol has a molecular weight of 336.60 g/mol, XLogP of 7.29, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-8-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]octan-1-ol is sourced from PubChem (CID 22808676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).