About 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol
7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol (PubChem CID 22808749) has the molecular formula C25H46O3
and a molecular weight of 394.64 g/mol. Its IUPAC name is 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol.
Molecular Properties
| Compound Name | 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol |
| PubChem CID | 22808749 |
| Molecular Formula | C25H46O3 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.34 |
| IUPAC Name | 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1CCC[C@@H]1CCCCCCCO)OC1CCCCO1 |
| InChI | InChI=1S/C25H46O3/c1-2-3-7-16-24(28-25-17-9-11-21-27-25)19-18-23-15-12-14-22(23)13-8-5-4-6-10-20-26/h18-19,22-26H,2-17,20-21H2,1H3/b19-18+/t22-,23+,24-,25?/m0/s1 |
| InChIKey | JISSHUBFRCVZEY-SDXYGMICSA-N |
| XLogP | 6.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol?
The IUPAC name of 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol (CID 22808749) is 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol.
What is the SMILES notation for 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol?
The canonical SMILES for 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol is CCCCC[C@@H](/C=C/[C@H]1CCC[C@@H]1CCCCCCCO)OC1CCCCO1.
What is the InChIKey of 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol?
The InChIKey is JISSHUBFRCVZEY-SDXYGMICSA-N. The full InChI is InChI=1S/C25H46O3/c1-2-3-7-16-24(28-25-17-9-11-21-27-25)19-18-23-15-12-14-22(23)13-8-5-4-6-10-20-26/h18-19,22-26H,2-17,20-21H2,1H3/b19-18+/t22-,23+,24-,25?/m0/s1.
What are the key properties of 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol?
7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol has a molecular weight of 394.64 g/mol, XLogP of 6.78, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(1S,2S)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]heptan-1-ol is sourced from PubChem (CID 22808749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).