C25H27N3O7 — CID 22808809
1-[(2R,4S,5R)-4-hydroxy-5-[1-hydroxy-2-(2-methylphenyl)-2-oxoethyl]-4-(2-methylbenzoyl)oxolan-2-yl]-5-methyl-1,3,5-triazinane-2,4-dione (PubChem CID 22808809) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-[1-hydroxy-2-(2-methylphenyl)-2-oxoethyl]-4-(2-methylbenzoyl)oxolan-2-yl]-5-methyl-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-[1-hydroxy-2-(2-methylphenyl)-2-oxoethyl]-4-(2-methylbenzoyl)oxolan-2-yl]-5-methyl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 22808809 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-[1-hydroxy-2-(2-methylphenyl)-2-oxoethyl]-4-(2-methylbenzoyl)oxolan-2-yl]-5-methyl-1,3,5-triazinane-2,4-dione |
| SMILES | Cc1ccccc1C(=O)C(O)[C@H]1O[C@@H](N2CN(C)C(=O)NC2=O)C[C@@]1(O)C(=O)c1ccccc1C |
| InChI | InChI=1S/C25H27N3O7/c1-14-8-4-6-10-16(14)19(29)20(30)22-25(34,21(31)17-11-7-5-9-15(17)2)12-18(35-22)28-13-27(3)23(32)26-24(28)33/h4-11,18,20,22,30,34H,12-13H2,1-3H3,(H,26,32,33)/t18-,20?,22-,25-/m1/s1 |
| InChIKey | PUBVBZGZCDTSLJ-VGBFSNKQSA-N |
| XLogP | 1.61 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |