C20H22O — CID 22808921
1-[(13S,14R,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 22808921) has the molecular formula C20H22O and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-[(13S,14R,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(13S,14R,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 22808921 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-[(13S,14R,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2c3ccc4ccccc4c3CC[C@]12C |
| InChI | InChI=1S/C20H22O/c1-13(21)18-9-10-19-17-8-7-14-5-3-4-6-15(14)16(17)11-12-20(18,19)2/h3-8,18-19H,9-12H2,1-2H3/t18-,19+,20-/m1/s1 |
| InChIKey | CXGDGEPAFIQPTD-HSALFYBXSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |