C30H38N2 — CID 22809238
(4aR,9bR)-2-(1-adamantylmethyl)-8-methyl-5-(4-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 22809238) has the molecular formula C30H38N2 and a molecular weight of 426.65 g/mol. Its IUPAC name is (4aR,9bR)-2-(1-adamantylmethyl)-8-methyl-5-(4-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | (4aR,9bR)-2-(1-adamantylmethyl)-8-methyl-5-(4-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 22809238 |
| Molecular Formula | C30H38N2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (4aR,9bR)-2-(1-adamantylmethyl)-8-methyl-5-(4-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc(N2c3ccc(C)cc3[C@@H]3CN(CC45CC6CC(CC(C6)C4)C5)CC[C@H]32)cc1 |
| InChI | InChI=1S/C30H38N2/c1-20-3-6-25(7-4-20)32-28-8-5-21(2)11-26(28)27-18-31(10-9-29(27)32)19-30-15-22-12-23(16-30)14-24(13-22)17-30/h3-8,11,22-24,27,29H,9-10,12-19H2,1-2H3/t22?,23?,24?,27-,29+,30?/m0/s1 |
| InChIKey | HTIYSTALQAIJBR-OAUUPEKASA-N |
| XLogP | 6.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |