C20H24N2 — CID 22809252
(4aR,9bR)-2,8-dimethyl-5-(4-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 22809252) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (4aR,9bR)-2,8-dimethyl-5-(4-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | (4aR,9bR)-2,8-dimethyl-5-(4-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 22809252 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (4aR,9bR)-2,8-dimethyl-5-(4-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc(N2c3ccc(C)cc3[C@@H]3CN(C)CC[C@H]32)cc1 |
| InChI | InChI=1S/C20H24N2/c1-14-4-7-16(8-5-14)22-19-9-6-15(2)12-17(19)18-13-21(3)11-10-20(18)22/h4-9,12,18,20H,10-11,13H2,1-3H3/t18-,20+/m0/s1 |
| InChIKey | PVIDLAJTKCUESM-AZUAARDMSA-N |
| XLogP | 4.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |