C23H36O6 — CID 22809723
(Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-6-methoxy-4,4-dimethylhex-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid (PubChem CID 22809723) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is (Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-6-methoxy-4,4-dimethylhex-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid.
| Compound Name | (Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-6-methoxy-4,4-dimethylhex-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 22809723 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-6-methoxy-4,4-dimethylhex-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid |
| SMILES | COCCC(C)(C)C/C=C/[C@H]1CCC(=O)[C@@H]1CCCC/C=C(\OC(C)=O)C(=O)O |
| InChI | InChI=1S/C23H36O6/c1-17(24)29-21(22(26)27)11-7-5-6-10-19-18(12-13-20(19)25)9-8-14-23(2,3)15-16-28-4/h8-9,11,18-19H,5-7,10,12-16H2,1-4H3,(H,26,27)/b9-8+,21-11-/t18-,19+/m0/s1 |
| InChIKey | LOFMUVNETWQMOI-YPPRGGRTSA-N |
| XLogP | 4.68 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|