C21H32O6 — CID 22809725
(Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-5-ethoxypent-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid (PubChem CID 22809725) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-5-ethoxypent-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid.
| Compound Name | (Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-5-ethoxypent-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 22809725 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-5-ethoxypent-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid |
| SMILES | CCOCCC/C=C/[C@H]1CCC(=O)[C@@H]1CCCC/C=C(\OC(C)=O)C(=O)O |
| InChI | InChI=1S/C21H32O6/c1-3-26-15-9-5-6-10-17-13-14-19(23)18(17)11-7-4-8-12-20(21(24)25)27-16(2)22/h6,10,12,17-18H,3-5,7-9,11,13-15H2,1-2H3,(H,24,25)/b10-6+,20-12-/t17-,18+/m0/s1 |
| InChIKey | URLYKBYHJORXIS-XHNBLFALSA-N |
| XLogP | 4.05 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|