C23H26O5 — CID 22809878
[(13S,14S,16R,17R)-17-hydroxy-17-(2-hydroxyacetyl)-13,16-dimethyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 22809878) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is [(13S,14S,16R,17R)-17-hydroxy-17-(2-hydroxyacetyl)-13,16-dimethyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(13S,14S,16R,17R)-17-hydroxy-17-(2-hydroxyacetyl)-13,16-dimethyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 22809878 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [(13S,14S,16R,17R)-17-hydroxy-17-(2-hydroxyacetyl)-13,16-dimethyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c(ccc2c1)[C@@H]1C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)CC3 |
| InChI | InChI=1S/C23H26O5/c1-13-10-20-19-6-4-15-11-16(28-14(2)25)5-7-17(15)18(19)8-9-22(20,3)23(13,27)21(26)12-24/h4-7,11,13,20,24,27H,8-10,12H2,1-3H3/t13-,20+,22+,23+/m1/s1 |
| InChIKey | KNXUCPAXTLALJC-RCQAABFZSA-N |
| XLogP | 3.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|