C23H26O3 — CID 22809888
4-[(13S,14R,16R,17S)-13,16-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoic acid (PubChem CID 22809888) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-[(13S,14R,16R,17S)-13,16-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(13S,14R,16R,17S)-13,16-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22809888 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-[(13S,14R,16R,17S)-13,16-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoic acid |
| SMILES | C[C@@H]1C[C@H]2c3ccc4ccccc4c3CC[C@]2(C)[C@H]1C(=O)CCC(=O)O |
| InChI | InChI=1S/C23H26O3/c1-14-13-19-18-8-7-15-5-3-4-6-16(15)17(18)11-12-23(19,2)22(14)20(24)9-10-21(25)26/h3-8,14,19,22H,9-13H2,1-2H3,(H,25,26)/t14-,19+,22-,23+/m1/s1 |
| InChIKey | JYHJOWPETBOGKU-XASMTTCRSA-N |
| XLogP | 4.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |