About [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate
[2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate (PubChem CID 22809967) has the molecular formula C11H11ClO4
and a molecular weight of 242.66 g/mol. Its IUPAC name is [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate.
Molecular Properties
| Compound Name | [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate |
| PubChem CID | 22809967 |
| Molecular Formula | C11H11ClO4 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate |
| SMILES | O=COc1ccccc1OC[C@@H]1O[C@H]1CCl |
| InChI | InChI=1S/C11H11ClO4/c12-5-10-11(16-10)6-14-8-3-1-2-4-9(8)15-7-13/h1-4,7,10-11H,5-6H2/t10-,11-/m0/s1 |
| InChIKey | GKFUSJSLXWYSNW-QWRGUYRKSA-N |
| XLogP | 1.61 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate?
The IUPAC name of [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate (CID 22809967) is [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate.
What is the SMILES notation for [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate?
The canonical SMILES for [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate is O=COc1ccccc1OC[C@@H]1O[C@H]1CCl.
What is the InChIKey of [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate?
The InChIKey is GKFUSJSLXWYSNW-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H11ClO4/c12-5-10-11(16-10)6-14-8-3-1-2-4-9(8)15-7-13/h1-4,7,10-11H,5-6H2/t10-,11-/m0/s1.
What are the key properties of [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate?
[2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate has a molecular weight of 242.66 g/mol, XLogP of 1.61, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methoxy]phenyl] formate is sourced from PubChem (CID 22809967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).