C11H15NO5S — CID 22811077
[(2R,3S,4R)-2-methyl-4-(methylamino)-3,4-dihydro-2H-chromen-3-yl] hydrogen sulfate (PubChem CID 22811077) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is [(2R,3S,4R)-2-methyl-4-(methylamino)-3,4-dihydro-2H-chromen-3-yl] hydrogen sulfate.
| Compound Name | [(2R,3S,4R)-2-methyl-4-(methylamino)-3,4-dihydro-2H-chromen-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 22811077 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | [(2R,3S,4R)-2-methyl-4-(methylamino)-3,4-dihydro-2H-chromen-3-yl] hydrogen sulfate |
| SMILES | CN[C@@H]1c2ccccc2O[C@H](C)[C@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C11H15NO5S/c1-7-11(17-18(13,14)15)10(12-2)8-5-3-4-6-9(8)16-7/h3-7,10-12H,1-2H3,(H,13,14,15)/t7-,10-,11-/m1/s1 |
| InChIKey | FWVGWDYBEYSEMH-AVPPRXQKSA-N |
| XLogP | 0.92 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|