C11H20N2O — CID 22811247
(5aR,9aR)-4,4-dimethyl-3,5,5a,6,7,8,9,9a-octahydro-1H-benzo[b][1,4]diazepin-2-one (PubChem CID 22811247) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is (5aR,9aR)-4,4-dimethyl-3,5,5a,6,7,8,9,9a-octahydro-1H-benzo[b][1,4]diazepin-2-one.
| Compound Name | (5aR,9aR)-4,4-dimethyl-3,5,5a,6,7,8,9,9a-octahydro-1H-benzo[b][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 22811247 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (5aR,9aR)-4,4-dimethyl-3,5,5a,6,7,8,9,9a-octahydro-1H-benzo[b][1,4]diazepin-2-one |
| SMILES | CC1(C)CC(=O)N[C@@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C11H20N2O/c1-11(2)7-10(14)12-8-5-3-4-6-9(8)13-11/h8-9,13H,3-7H2,1-2H3,(H,12,14)/t8-,9-/m1/s1 |
| InChIKey | HERSNCSJFDWFTA-RKDXNWHRSA-N |
| XLogP | 1.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |