C20H35N — CID 22811540
(4E,8E)-11-methyl-2-pentan-2-yl-11-propyl-1-azacyclododeca-4,8,12-triene (PubChem CID 22811540) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is (4E,8E)-11-methyl-2-pentan-2-yl-11-propyl-1-azacyclododeca-4,8,12-triene.
| Compound Name | (4E,8E)-11-methyl-2-pentan-2-yl-11-propyl-1-azacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 22811540 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | (4E,8E)-11-methyl-2-pentan-2-yl-11-propyl-1-azacyclododeca-4,8,12-triene |
| SMILES | CCCC(C)C1C/C=C/CC/C=C/CC(C)(CCC)/C=N/1 |
| InChI | InChI=1S/C20H35N/c1-5-13-18(3)19-14-11-9-7-8-10-12-16-20(4,15-6-2)17-21-19/h9-12,17-19H,5-8,13-16H2,1-4H3/b11-9+,12-10+,21-17+ |
| InChIKey | FJVNSBUBZGDABL-UDHPBDKWSA-N |
| XLogP | 6.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|