C14H23N — CID 22811541
(4E,8E)-2,2,11-trimethyl-1-azacyclododeca-4,8,12-triene (PubChem CID 22811541) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (4E,8E)-2,2,11-trimethyl-1-azacyclododeca-4,8,12-triene.
| Compound Name | (4E,8E)-2,2,11-trimethyl-1-azacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 22811541 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (4E,8E)-2,2,11-trimethyl-1-azacyclododeca-4,8,12-triene |
| SMILES | CC1/C=N/C(C)(C)C/C=C/CC/C=C/C1 |
| InChI | InChI=1S/C14H23N/c1-13-10-8-6-4-5-7-9-11-14(2,3)15-12-13/h6-9,12-13H,4-5,10-11H2,1-3H3/b8-6+,9-7+,15-12+ |
| InChIKey | BKZDKNQEVKGXSL-VDABPQPGSA-N |
| XLogP | 4.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|