C19H33N — CID 22811542
(4E,8E)-11-butyl-2,11-diethyl-1-azacyclododeca-4,8,12-triene (PubChem CID 22811542) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is (4E,8E)-11-butyl-2,11-diethyl-1-azacyclododeca-4,8,12-triene.
| Compound Name | (4E,8E)-11-butyl-2,11-diethyl-1-azacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 22811542 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | (4E,8E)-11-butyl-2,11-diethyl-1-azacyclododeca-4,8,12-triene |
| SMILES | CCCCC1(CC)/C=N/C(CC)C/C=C/CC/C=C/C1 |
| InChI | InChI=1S/C19H33N/c1-4-7-15-19(6-3)16-13-11-9-8-10-12-14-18(5-2)20-17-19/h10-13,17-18H,4-9,14-16H2,1-3H3/b12-10+,13-11+,20-17+ |
| InChIKey | PASVQKQOMVVDHD-DWBJYNNQSA-N |
| XLogP | 6.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|