C15H24O6 — CID 22811556
2-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-(3-oxopropyl)cyclopentyl]acetic acid (PubChem CID 22811556) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-(3-oxopropyl)cyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-(3-oxopropyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 22811556 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-(3-oxopropyl)cyclopentyl]acetic acid |
| SMILES | O=CCC[C@@H]1[C@@H](CC(=O)O)[C@@H](O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C15H24O6/c16-6-3-4-10-11(8-14(18)19)12(17)9-13(10)21-15-5-1-2-7-20-15/h6,10-13,15,17H,1-5,7-9H2,(H,18,19)/t10-,11-,12+,13-,15?/m1/s1 |
| InChIKey | JUVIQUJEYNPSHB-CKMVWSRUSA-N |
| XLogP | 1.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|