C15H21N2O5P — CID 22811652
[1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidin-2-yl]phosphonous acid (PubChem CID 22811652) has the molecular formula C15H21N2O5P and a molecular weight of 340.32 g/mol. Its IUPAC name is [1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidin-2-yl]phosphonous acid.
| Compound Name | [1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidin-2-yl]phosphonous acid |
|---|---|
| PubChem CID | 22811652 |
| Molecular Formula | C15H21N2O5P |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidin-2-yl]phosphonous acid |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCCC1P(O)O |
| InChI | InChI=1S/C15H21N2O5P/c1-11(14(18)17-9-5-8-13(17)23(20)21)16-15(19)22-10-12-6-3-2-4-7-12/h2-4,6-7,11,13,20-21H,5,8-10H2,1H3,(H,16,19)/t11-,13?/m0/s1 |
| InChIKey | LBSJWXZRLABENO-AMGKYWFPSA-N |
| XLogP | 1.55 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|