C12H10N2O3S — CID 22811976
(5S)-6-amino-7-oxo-3-phenyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 22811976) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is (5S)-6-amino-7-oxo-3-phenyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5S)-6-amino-7-oxo-3-phenyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22811976 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | (5S)-6-amino-7-oxo-3-phenyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | NC1C(=O)N2C(C(=O)O)=C(c3ccccc3)S[C@@H]12 |
| InChI | InChI=1S/C12H10N2O3S/c13-7-10(15)14-8(12(16)17)9(18-11(7)14)6-4-2-1-3-5-6/h1-5,7,11H,13H2,(H,16,17)/t7?,11-/m0/s1 |
| InChIKey | DMLIGVJYVIKODB-QRIDDKLISA-N |
| XLogP | 0.68 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |