About (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one
(1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one (PubChem CID 22812127) has the molecular formula C4H4N2O2
and a molecular weight of 112.09 g/mol. Its IUPAC name is (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one.
Molecular Properties
| Compound Name | (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one |
| PubChem CID | 22812127 |
| Molecular Formula | C4H4N2O2 |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 112.03 |
| IUPAC Name | (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one |
| SMILES | O=C1N[C@H]2OC=N[C@@H]12 |
| InChI | InChI=1S/C4H4N2O2/c7-3-2-4(6-3)8-1-5-2/h1-2,4H,(H,6,7)/t2-,4-/m0/s1 |
| InChIKey | WDFDRKNYPVBAOK-OKKQSCSOSA-N |
| XLogP | -1.13 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one?
The IUPAC name of (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one (CID 22812127) is (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one.
What is the SMILES notation for (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one?
The canonical SMILES for (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one is O=C1N[C@H]2OC=N[C@@H]12.
What is the InChIKey of (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one?
The InChIKey is WDFDRKNYPVBAOK-OKKQSCSOSA-N. The full InChI is InChI=1S/C4H4N2O2/c7-3-2-4(6-3)8-1-5-2/h1-2,4H,(H,6,7)/t2-,4-/m0/s1.
What are the key properties of (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one?
(1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one has a molecular weight of 112.09 g/mol, XLogP of -1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one is sourced from PubChem (CID 22812127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).