C23H34O4 — CID 22812362
(8R,9S,10R,13S,14S,17R)-17-acetyl-17-(ethoxymethoxy)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 22812362) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-17-acetyl-17-(ethoxymethoxy)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17R)-17-acetyl-17-(ethoxymethoxy)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22812362 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-acetyl-17-(ethoxymethoxy)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCOCO[C@]1(C(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H34O4/c1-4-26-14-27-23(15(2)24)12-10-21-20-7-5-16-13-17(25)6-8-18(16)19(20)9-11-22(21,23)3/h13,18-21H,4-12,14H2,1-3H3/t18-,19+,20+,21-,22-,23-/m0/s1 |
| InChIKey | IKHPLFQWVSWIST-GOMYTPFNSA-N |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|