C13H26N2O6 — CID 22812629
7-amino-N-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]heptanamide (PubChem CID 22812629) has the molecular formula C13H26N2O6 and a molecular weight of 306.36 g/mol. Its IUPAC name is 7-amino-N-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]heptanamide.
| Compound Name | 7-amino-N-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]heptanamide |
|---|---|
| PubChem CID | 22812629 |
| Molecular Formula | C13H26N2O6 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 7-amino-N-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]heptanamide |
| SMILES | NCCCCCCC(=O)N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H26N2O6/c14-6-4-2-1-3-5-9(17)15-13-12(20)11(19)10(18)8(7-16)21-13/h8,10-13,16,18-20H,1-7,14H2,(H,15,17)/t8-,10-,11+,12+,13-/m1/s1 |
| InChIKey | CIRZPBJQRGALMW-RFSPMECJSA-N |
| XLogP | -2.19 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|