C20H29NO9S — CID 22812636
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(5-cyanopentylsulfanyl)oxan-2-yl]methyl acetate (PubChem CID 22812636) has the molecular formula C20H29NO9S and a molecular weight of 459.52 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(5-cyanopentylsulfanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(5-cyanopentylsulfanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22812636 |
| Molecular Formula | C20H29NO9S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(5-cyanopentylsulfanyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](SCCCCCC#N)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H29NO9S/c1-12(22)26-11-16-17(27-13(2)23)18(28-14(3)24)19(29-15(4)25)20(30-16)31-10-8-6-5-7-9-21/h16-20H,5-8,10-11H2,1-4H3/t16-,17-,18+,19+,20-/m1/s1 |
| InChIKey | DXFHADRYHQXNIC-SWBPCFCJSA-N |
| XLogP | 1.89 |
| TPSA | 138.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|