C11H20O5 — CID 22812792
3-[(1S,2R,5R)-2-(dimethoxymethyl)-5-hydroxycyclopentyl]propanoic acid (PubChem CID 22812792) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-[(1S,2R,5R)-2-(dimethoxymethyl)-5-hydroxycyclopentyl]propanoic acid.
| Compound Name | 3-[(1S,2R,5R)-2-(dimethoxymethyl)-5-hydroxycyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 22812792 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 3-[(1S,2R,5R)-2-(dimethoxymethyl)-5-hydroxycyclopentyl]propanoic acid |
| SMILES | COC(OC)[C@@H]1CC[C@@H](O)[C@H]1CCC(=O)O |
| InChI | InChI=1S/C11H20O5/c1-15-11(16-2)8-3-5-9(12)7(8)4-6-10(13)14/h7-9,11-12H,3-6H2,1-2H3,(H,13,14)/t7-,8+,9+/m0/s1 |
| InChIKey | XOMJCRDBYAESRS-DJLDLDEBSA-N |
| XLogP | 0.86 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|