C23H37FO6 — CID 22813267
5-[(2S,3aR,4R,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methoxycarbonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-2-methylpentanoic acid (PubChem CID 22813267) has the molecular formula C23H37FO6 and a molecular weight of 428.54 g/mol. Its IUPAC name is 5-[(2S,3aR,4R,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methoxycarbonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-2-methylpentanoic acid.
| Compound Name | 5-[(2S,3aR,4R,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methoxycarbonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 22813267 |
| Molecular Formula | C23H37FO6 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 5-[(2S,3aR,4R,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methoxycarbonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-2-methylpentanoic acid |
| SMILES | CCCC[C@@H](F)[C@H](O)/C=C/[C@@H]1[C@H]2C[C@H](CCCC(C)C(=O)O)O[C@H]2C[C@H]1C(=O)OC |
| InChI | InChI=1S/C23H37FO6/c1-4-5-9-19(24)20(25)11-10-16-17-12-15(8-6-7-14(2)22(26)27)30-21(17)13-18(16)23(28)29-3/h10-11,14-21,25H,4-9,12-13H2,1-3H3,(H,26,27)/b11-10+/t14?,15-,16+,17+,18+,19+,20+,21-/m0/s1 |
| InChIKey | XRRYUGQWKSFGDR-UJXUWLNUSA-N |
| XLogP | 3.91 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|