C21H34F2O4 — CID 22813270
5-[(2S,3aR,4S,5R,6aS)-4-[(E,3R)-4,4-difluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid (PubChem CID 22813270) has the molecular formula C21H34F2O4 and a molecular weight of 388.50 g/mol. Its IUPAC name is 5-[(2S,3aR,4S,5R,6aS)-4-[(E,3R)-4,4-difluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid.
| Compound Name | 5-[(2S,3aR,4S,5R,6aS)-4-[(E,3R)-4,4-difluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 22813270 |
| Molecular Formula | C21H34F2O4 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 5-[(2S,3aR,4S,5R,6aS)-4-[(E,3R)-4,4-difluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid |
| SMILES | CCCCC(F)(F)[C@H](O)/C=C/[C@H]1[C@H]2C[C@H](CCCCC(=O)O)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C21H34F2O4/c1-3-4-11-21(22,23)19(24)10-9-16-14(2)12-18-17(16)13-15(27-18)7-5-6-8-20(25)26/h9-10,14-19,24H,3-8,11-13H2,1-2H3,(H,25,26)/b10-9+/t14-,15+,16-,17-,18+,19-/m1/s1 |
| InChIKey | PYBRXKGLTQSSCB-RWBRWRTLSA-N |
| XLogP | 4.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|