C21H33FO6 — CID 22813300
(2S,3aR,4S,5R,6aS)-2-(4-carboxybutyl)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid (PubChem CID 22813300) has the molecular formula C21H33FO6 and a molecular weight of 400.49 g/mol. Its IUPAC name is (2S,3aR,4S,5R,6aS)-2-(4-carboxybutyl)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid.
| Compound Name | (2S,3aR,4S,5R,6aS)-2-(4-carboxybutyl)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid |
|---|---|
| PubChem CID | 22813300 |
| Molecular Formula | C21H33FO6 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (2S,3aR,4S,5R,6aS)-2-(4-carboxybutyl)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid |
| SMILES | CCCC[C@@H](F)[C@H](O)/C=C/[C@H]1[C@H]2C[C@H](CCCCC(=O)O)O[C@H]2C[C@H]1C(=O)O |
| InChI | InChI=1S/C21H33FO6/c1-2-3-7-17(22)18(23)10-9-14-15-11-13(6-4-5-8-20(24)25)28-19(15)12-16(14)21(26)27/h9-10,13-19,23H,2-8,11-12H2,1H3,(H,24,25)(H,26,27)/b10-9+/t13-,14-,15+,16+,17+,18+,19-/m0/s1 |
| InChIKey | KEMLVCFKJDKFDA-LTPPVCLXSA-N |
| XLogP | 3.57 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|