C21H37FO4 — CID 22813302
5-[(2S,3aR,4S,5R,6aS)-4-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid (PubChem CID 22813302) has the molecular formula C21H37FO4 and a molecular weight of 372.52 g/mol. Its IUPAC name is 5-[(2S,3aR,4S,5R,6aS)-4-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid.
| Compound Name | 5-[(2S,3aR,4S,5R,6aS)-4-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 22813302 |
| Molecular Formula | C21H37FO4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 5-[(2S,3aR,4S,5R,6aS)-4-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid |
| SMILES | CCCC[C@@H](F)[C@H](O)CC[C@@H]1[C@H]2C[C@H](CCCCC(=O)O)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C21H37FO4/c1-3-4-8-18(22)19(23)11-10-16-14(2)12-20-17(16)13-15(26-20)7-5-6-9-21(24)25/h14-20,23H,3-13H2,1-2H3,(H,24,25)/t14-,15+,16+,17-,18-,19-,20+/m1/s1 |
| InChIKey | HKYVYJACPYQLQV-GAZIBBPMSA-N |
| XLogP | 4.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|