C14H16N2O — CID 22813386
(2R,7R)-6-methyl-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene (PubChem CID 22813386) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is (2R,7R)-6-methyl-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene.
| Compound Name | (2R,7R)-6-methyl-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene |
|---|---|
| PubChem CID | 22813386 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (2R,7R)-6-methyl-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene |
| SMILES | CN1CCO[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C14H16N2O/c1-16-5-6-17-14-10-3-2-4-11-13(10)9(8-15-11)7-12(14)16/h2-4,8,12,14-15H,5-7H2,1H3/t12-,14-/m1/s1 |
| InChIKey | VWJKGTFOQGCXGH-TZMCWYRMSA-N |
| XLogP | 2.10 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |