C15H21IO10 — CID 22813401
methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-iodoethoxy)oxane-2-carboxylate (PubChem CID 22813401) has the molecular formula C15H21IO10 and a molecular weight of 488.23 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-iodoethoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-iodoethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 22813401 |
| Molecular Formula | C15H21IO10 |
| Molecular Weight | 488.23 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-iodoethoxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](OCCI)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H21IO10/c1-7(17)23-10-11(24-8(2)18)13(25-9(3)19)15(22-6-5-16)26-12(10)14(20)21-4/h10-13,15H,5-6H2,1-4H3/t10-,11-,12-,13+,15+/m0/s1 |
| InChIKey | DVNOXCLPYIPEES-XOBFJNJYSA-N |
| XLogP | 0.13 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|