C26H26Cl2O7 — CID 22813450
dimethyl 1-benzyl-5-[[(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]oxymethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 22813450) has the molecular formula C26H26Cl2O7 and a molecular weight of 521.39 g/mol. Its IUPAC name is dimethyl 1-benzyl-5-[[(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]oxymethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-5-[[(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]oxymethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 22813450 |
| Molecular Formula | C26H26Cl2O7 |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | dimethyl 1-benzyl-5-[[(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]oxymethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(Cc3ccccc3)C=C(COC(=O)[C@@H]3[C@H](C=C(Cl)Cl)C3(C)C)C1O2 |
| InChI | InChI=1S/C26H26Cl2O7/c1-25(2)16(10-17(27)28)19(25)24(31)34-13-15-12-26(11-14-8-6-5-7-9-14)20(23(30)33-4)18(21(15)35-26)22(29)32-3/h5-10,12,16,19,21H,11,13H2,1-4H3/t16-,19-,21?,26?/m0/s1 |
| InChIKey | DQWQEAHMNSTDAT-YCEDDERPSA-N |
| XLogP | 4.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|