C6H14O7 — CID 22814120
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrate (PubChem CID 22814120) has the molecular formula C6H14O7 and a molecular weight of 198.17 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrate.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrate |
|---|---|
| PubChem CID | 22814120 |
| Molecular Formula | C6H14O7 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrate |
| SMILES | O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.H2O/c7-1-3(9)5(11)6(12)4(10)2-8;/h1,3-6,8-12H,2H2;1H2/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | SPFMQWBKVUQXJV-BTVCFUMJSA-N |
| XLogP | -4.20 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|