C17H32O2 — CID 22814176
(E,10R)-14-hydroxy-10,14-dimethylpentadec-7-en-6-one (PubChem CID 22814176) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (E,10R)-14-hydroxy-10,14-dimethylpentadec-7-en-6-one.
| Compound Name | (E,10R)-14-hydroxy-10,14-dimethylpentadec-7-en-6-one |
|---|---|
| PubChem CID | 22814176 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (E,10R)-14-hydroxy-10,14-dimethylpentadec-7-en-6-one |
| SMILES | CCCCCC(=O)/C=C/C[C@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C17H32O2/c1-5-6-7-12-16(18)13-8-10-15(2)11-9-14-17(3,4)19/h8,13,15,19H,5-7,9-12,14H2,1-4H3/b13-8+/t15-/m0/s1 |
| InChIKey | HRMQHPFCMVUTNH-NRUITVPNSA-N |
| XLogP | 4.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|