C27H43NO — CID 22814521
N-(2-methylphenyl)-8-[(1R,2R)-2-[[(1S,2S)-2-pentylcyclopropyl]methyl]cyclopropyl]octanamide (PubChem CID 22814521) has the molecular formula C27H43NO and a molecular weight of 397.65 g/mol. Its IUPAC name is N-(2-methylphenyl)-8-[(1R,2R)-2-[[(1S,2S)-2-pentylcyclopropyl]methyl]cyclopropyl]octanamide.
| Compound Name | N-(2-methylphenyl)-8-[(1R,2R)-2-[[(1S,2S)-2-pentylcyclopropyl]methyl]cyclopropyl]octanamide |
|---|---|
| PubChem CID | 22814521 |
| Molecular Formula | C27H43NO |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 397.33 |
| IUPAC Name | N-(2-methylphenyl)-8-[(1R,2R)-2-[[(1S,2S)-2-pentylcyclopropyl]methyl]cyclopropyl]octanamide |
| SMILES | CCCCC[C@H]1C[C@H]1C[C@H]1C[C@H]1CCCCCCCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C27H43NO/c1-3-4-8-14-22-18-24(22)20-25-19-23(25)15-9-6-5-7-10-17-27(29)28-26-16-12-11-13-21(26)2/h11-13,16,22-25H,3-10,14-15,17-20H2,1-2H3,(H,28,29)/t22-,23+,24-,25+/m0/s1 |
| InChIKey | ACSZHVIBQIYJSL-FQUZAXHOSA-N |
| XLogP | 7.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|