About (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol
(1R,5S)-bicyclo[3.2.0]heptane-6,7-diol (PubChem CID 22814734) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol.
Molecular Properties
| Compound Name | (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol |
| PubChem CID | 22814734 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol |
| SMILES | OC1C(O)[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C7H12O2/c8-6-4-2-1-3-5(4)7(6)9/h4-9H,1-3H2/t4-,5+,6?,7? |
| InChIKey | ULIXDJDHERXNPA-DPTVFECHSA-N |
| XLogP | 0.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol?
The IUPAC name of (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol (CID 22814734) is (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol.
What is the SMILES notation for (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol?
The canonical SMILES for (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol is OC1C(O)[C@@H]2CCC[C@H]12.
What is the InChIKey of (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol?
The InChIKey is ULIXDJDHERXNPA-DPTVFECHSA-N. The full InChI is InChI=1S/C7H12O2/c8-6-4-2-1-3-5(4)7(6)9/h4-9H,1-3H2/t4-,5+,6?,7?.
What are the key properties of (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol?
(1R,5S)-bicyclo[3.2.0]heptane-6,7-diol has a molecular weight of 128.17 g/mol, XLogP of 0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-bicyclo[3.2.0]heptane-6,7-diol is sourced from PubChem (CID 22814734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).