C13H16N2O3 — CID 22815021
[(1R,2S)-2-aminocyclopent-3-en-1-yl]oxy-benzylcarbamic acid (PubChem CID 22815021) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is [(1R,2S)-2-aminocyclopent-3-en-1-yl]oxy-benzylcarbamic acid.
| Compound Name | [(1R,2S)-2-aminocyclopent-3-en-1-yl]oxy-benzylcarbamic acid |
|---|---|
| PubChem CID | 22815021 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [(1R,2S)-2-aminocyclopent-3-en-1-yl]oxy-benzylcarbamic acid |
| SMILES | N[C@H]1C=CC[C@H]1ON(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H16N2O3/c14-11-7-4-8-12(11)18-15(13(16)17)9-10-5-2-1-3-6-10/h1-7,11-12H,8-9,14H2,(H,16,17)/t11-,12+/m0/s1 |
| InChIKey | WMADMGSPKMLGNI-NWDGAFQWSA-N |
| XLogP | 1.75 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|