C21H26ClFO5 — CID 22815471
(8S,9R,10S,11S,13S,14S,16S,17R)-4-chloro-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 22815471) has the molecular formula C21H26ClFO5 and a molecular weight of 412.89 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S,16S,17R)-4-chloro-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (8S,9R,10S,11S,13S,14S,16S,17R)-4-chloro-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 22815471 |
| Molecular Formula | C21H26ClFO5 |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,16S,17R)-4-chloro-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CCC4=C(Cl)C(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)O |
| InChI | InChI=1S/C21H26ClFO5/c1-10-8-13-11-4-5-12-16(22)14(24)6-7-18(12,2)20(11,23)15(25)9-19(13,3)21(10,28)17(26)27/h6-7,10-11,13,15,25,28H,4-5,8-9H2,1-3H3,(H,26,27)/t10-,11-,13-,15-,18-,19-,20-,21-/m0/s1 |
| InChIKey | QEPOBZAOXWZSTE-OGZKTBPKSA-N |
| XLogP | 2.99 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|