C21H15N3O4 — CID 2281557
N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-methyl-3-nitrobenzamide (PubChem CID 2281557) has the molecular formula C21H15N3O4 and a molecular weight of 373.37 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 2281557 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)Nc2ccc(-c3nc4ccccc4o3)cc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H15N3O4/c1-13-16(5-4-7-18(13)24(26)27)20(25)22-15-11-9-14(10-12-15)21-23-17-6-2-3-8-19(17)28-21/h2-12H,1H3,(H,22,25) |
| InChIKey | NLJRQOWEAKSHJN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|