C11H17NO4 — CID 22815895
(3aS,4R,5R,6aR)-5-hydroxy-4-morpholin-4-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 22815895) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-5-hydroxy-4-morpholin-4-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,4R,5R,6aR)-5-hydroxy-4-morpholin-4-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 22815895 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (3aS,4R,5R,6aR)-5-hydroxy-4-morpholin-4-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@H]2[C@@H](N3CCOCC3)[C@H](O)C[C@H]2O1 |
| InChI | InChI=1S/C11H17NO4/c13-8-6-9-7(5-10(14)16-9)11(8)12-1-3-15-4-2-12/h7-9,11,13H,1-6H2/t7-,8-,9-,11-/m1/s1 |
| InChIKey | NUJLDHAPYHKHEB-TURQNECASA-N |
| XLogP | -0.62 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |