C19H30O2 — CID 22816081
(7aS)-4-but-3-enyl-2,7a-dimethyl-1-[(2-methylpropan-2-yl)oxy]-2,3,6,7-tetrahydro-1H-inden-5-one (PubChem CID 22816081) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (7aS)-4-but-3-enyl-2,7a-dimethyl-1-[(2-methylpropan-2-yl)oxy]-2,3,6,7-tetrahydro-1H-inden-5-one.
| Compound Name | (7aS)-4-but-3-enyl-2,7a-dimethyl-1-[(2-methylpropan-2-yl)oxy]-2,3,6,7-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 22816081 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (7aS)-4-but-3-enyl-2,7a-dimethyl-1-[(2-methylpropan-2-yl)oxy]-2,3,6,7-tetrahydro-1H-inden-5-one |
| SMILES | C=CCCC1=C2CC(C)C(OC(C)(C)C)[C@@]2(C)CCC1=O |
| InChI | InChI=1S/C19H30O2/c1-7-8-9-14-15-12-13(2)17(21-18(3,4)5)19(15,6)11-10-16(14)20/h7,13,17H,1,8-12H2,2-6H3/t13?,17?,19-/m0/s1 |
| InChIKey | PGAVBVISNRYRHQ-JVMACKPJSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|