C15H13ClN2O4 — CID 22816221
(2R)-3-(chloromethyl)-2-[(1R,5S)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid (PubChem CID 22816221) has the molecular formula C15H13ClN2O4 and a molecular weight of 320.73 g/mol. Its IUPAC name is (2R)-3-(chloromethyl)-2-[(1R,5S)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid.
| Compound Name | (2R)-3-(chloromethyl)-2-[(1R,5S)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid |
|---|---|
| PubChem CID | 22816221 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (2R)-3-(chloromethyl)-2-[(1R,5S)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid |
| SMILES | C=C(CCl)[C@H](C(=O)O)N1C(=O)[C@@H]2N=C(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C15H13ClN2O4/c1-8(7-16)11(15(20)21)18-13(19)10-14(18)22-12(17-10)9-5-3-2-4-6-9/h2-6,10-11,14H,1,7H2,(H,20,21)/t10-,11+,14-/m0/s1 |
| InChIKey | FONWQSCKPRAPNM-WDMOLILDSA-N |
| XLogP | 1.25 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|