C12H15F3NO5S+ — CID 22817841
(2R)-1-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-2-methyl-4-oxopyrrolidin-1-ium-1-carboxylic acid (PubChem CID 22817841) has the molecular formula C12H15F3NO5S+ and a molecular weight of 342.32 g/mol. Its IUPAC name is (2R)-1-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-2-methyl-4-oxopyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-2-methyl-4-oxopyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 22817841 |
| Molecular Formula | C12H15F3NO5S+ |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (2R)-1-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-2-methyl-4-oxopyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SCC(C(=O)[N+]1(C(=O)O)CC(=O)C[C@H]1C)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO5S/c1-6-3-8(18)4-16(6,11(20)21)10(19)9(12(13,14)15)5-22-7(2)17/h6,9H,3-5H2,1-2H3/p+1/t6-,9?,16?/m1/s1 |
| InChIKey | PHZIJRXYHKBEON-YBVIVYLXSA-O |
| XLogP | 1.83 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|