C20H29NO2 — CID 22818575
(4aR,8aR)-2-(cyclobutylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-ol (PubChem CID 22818575) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (4aR,8aR)-2-(cyclobutylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-ol.
| Compound Name | (4aR,8aR)-2-(cyclobutylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-ol |
|---|---|
| PubChem CID | 22818575 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (4aR,8aR)-2-(cyclobutylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-ol |
| SMILES | Oc1cccc([C@@]23CCN(CC4CCC4)C[C@@H]2CCC(O)C3)c1 |
| InChI | InChI=1S/C20H29NO2/c22-18-6-2-5-16(11-18)20-9-10-21(13-15-3-1-4-15)14-17(20)7-8-19(23)12-20/h2,5-6,11,15,17,19,22-23H,1,3-4,7-10,12-14H2/t17-,19?,20-/m0/s1 |
| InChIKey | ITOALQJWKINIDZ-SPFPWHRZSA-N |
| XLogP | 3.30 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |