C23H26ClNO2 — CID 22818582
(4aR,8aR)-2-[2-(2-chlorophenyl)ethyl]-4a-(3-hydroxyphenyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one (PubChem CID 22818582) has the molecular formula C23H26ClNO2 and a molecular weight of 383.92 g/mol. Its IUPAC name is (4aR,8aR)-2-[2-(2-chlorophenyl)ethyl]-4a-(3-hydroxyphenyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one.
| Compound Name | (4aR,8aR)-2-[2-(2-chlorophenyl)ethyl]-4a-(3-hydroxyphenyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 22818582 |
| Molecular Formula | C23H26ClNO2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (4aR,8aR)-2-[2-(2-chlorophenyl)ethyl]-4a-(3-hydroxyphenyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one |
| SMILES | O=C1CC[C@H]2CN(CCc3ccccc3Cl)CC[C@@]2(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C23H26ClNO2/c24-22-7-2-1-4-17(22)10-12-25-13-11-23(18-5-3-6-20(26)14-18)15-21(27)9-8-19(23)16-25/h1-7,14,19,26H,8-13,15-16H2/t19-,23-/m0/s1 |
| InChIKey | WZXSPUPTWZHOJJ-CVDCTZTESA-N |
| XLogP | 4.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |